Br7an0Jihbamber Br7an0Jihbamber

08-05-2016
History

contestada

Advancements in mathematics led the Maya to the use of which of the following about 800 years before Europeans?
A. the number zero
B. multiplication
C. the decimal
D. fractions

Respuesta :

25hallsk48 25hallsk48

18-01-2019

the answer is A-the number zero (hope i helped!)

Answer Link

Otras preguntas

Simplify 15.5 divided by 5

Iron oxide reacts with aluminum to give aluminum oxide and iron. What kind of chemical reaction is this?

Which component of physical fitness is skill related

One reason that the quantity demanded of a good increases when its price falls is that the:

which statement is true about the expression 12-7+3

A triangle is enlarged by a factor of 3. The perimeter of the new triangle is 36 feet. What could be the lengths of the sides of the original triangle? 3 feet,

Use an appropriate identity to find the exact value of the expression. cos(310)cos(50)-sin(310)sin(50)

What is the purpose of the author’s description of Della’s hair and clothing?

4×1+22−4÷2 Express your answer as an integer.

which one of the following points was a requirement of the Wade-davis Bill?a. 10% of the voters had to swear loyalty to the Union?b. A military how to raise new